Benzene and substituted derivatives
Filtered Search Results
2,6-Bis(trifluoromethyl)benzeneboronic acid, 97%
CAS: 681812-07-7 Molecular Formula: C8H5BF6O2 Molecular Weight (g/mol): 257.926 MDL Number: MFCD04039321 InChI Key: WAMPGNNEOZGBHR-UHFFFAOYSA-N Synonym: 2,6-bis trifluoromethyl phenyl boronic acid,2,6-bis trifluoromethyl phenylboronic acid,2,6-bis trifluoromethyl benzeneboronic acid,2,6-ditrifluoromethylphenyl boronic acid,boronic acid, 2,6-bis trifluoromethyl phenyl,acmc-1b92w,ablock ab-13-3574,2,6-bis-trifluoromethyl benzeneboronic acid PubChem CID: 2783239 IUPAC Name: [2,6-bis(trifluoromethyl)phenyl]boronic acid SMILES: B(C1=C(C=CC=C1C(F)(F)F)C(F)(F)F)(O)O
| PubChem CID | 2783239 |
|---|---|
| CAS | 681812-07-7 |
| Molecular Weight (g/mol) | 257.926 |
| MDL Number | MFCD04039321 |
| SMILES | B(C1=C(C=CC=C1C(F)(F)F)C(F)(F)F)(O)O |
| Synonym | 2,6-bis trifluoromethyl phenyl boronic acid,2,6-bis trifluoromethyl phenylboronic acid,2,6-bis trifluoromethyl benzeneboronic acid,2,6-ditrifluoromethylphenyl boronic acid,boronic acid, 2,6-bis trifluoromethyl phenyl,acmc-1b92w,ablock ab-13-3574,2,6-bis-trifluoromethyl benzeneboronic acid |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]boronic acid |
| InChI Key | WAMPGNNEOZGBHR-UHFFFAOYSA-N |
| Molecular Formula | C8H5BF6O2 |
N-Methyl-3-(1H-pyrazol-1-ylmethyl)benzylamine, 90%, Thermo Scientific™
CAS: 892502-10-2 Molecular Formula: C12H15N3 Molecular Weight (g/mol): 201.273 MDL Number: MFCD08690303 InChI Key: RXKBCAGRFVIQTK-UHFFFAOYSA-N Synonym: n-methyl-3-1h-pyrazol-1-ylmethyl benzylamine,methyl 3-pyrazol-1-ylmethyl phenyl methyl amine,methyl 3-pyrazolylmethyl phenyl methyl amine,benzenemethanamine,n-methyl-3-1h-pyrazol-1-ylmethyl,1-3-1h-pyrazol-1-yl methyl phenyl-n-methylmethanamine,n-methyl-1-3-1h-pyrazol-1-yl methyl phenyl methanamine PubChem CID: 18525881 IUPAC Name: N-methyl-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine SMILES: CNCC1=CC=CC(=C1)CN2C=CC=N2
| PubChem CID | 18525881 |
|---|---|
| CAS | 892502-10-2 |
| Molecular Weight (g/mol) | 201.273 |
| MDL Number | MFCD08690303 |
| SMILES | CNCC1=CC=CC(=C1)CN2C=CC=N2 |
| Synonym | n-methyl-3-1h-pyrazol-1-ylmethyl benzylamine,methyl 3-pyrazol-1-ylmethyl phenyl methyl amine,methyl 3-pyrazolylmethyl phenyl methyl amine,benzenemethanamine,n-methyl-3-1h-pyrazol-1-ylmethyl,1-3-1h-pyrazol-1-yl methyl phenyl-n-methylmethanamine,n-methyl-1-3-1h-pyrazol-1-yl methyl phenyl methanamine |
| IUPAC Name | N-methyl-1-[3-(pyrazol-1-ylmethyl)phenyl]methanamine |
| InChI Key | RXKBCAGRFVIQTK-UHFFFAOYSA-N |
| Molecular Formula | C12H15N3 |
Sodium 4-aminosalicylate dihydrate, 98%
CAS: 6018-19-5 Molecular Formula: C7H10NNaO5 Molecular Weight (g/mol): 211.149 MDL Number: MFCD00151044 InChI Key: GMUQJDAYXZXBOT-UHFFFAOYSA-M Synonym: sodium 4-aminosalicylate dihydrate,sodium 4-amino-2-hydroxybenzoate dihydrate,parasal sodium,4-aminosalicylic acid sodium salt dihydrate,unii-s38b9w6axw,aminosalicylate sodium,sodium aminosalicylate,sodium p.a.s.,s38b9w6axw,aminosalicylate sodium usp PubChem CID: 16211148 IUPAC Name: sodium;4-amino-2-hydroxybenzoate;dihydrate SMILES: C1=CC(=C(C=C1N)O)C(=O)[O-].O.O.[Na+]
| PubChem CID | 16211148 |
|---|---|
| CAS | 6018-19-5 |
| Molecular Weight (g/mol) | 211.149 |
| MDL Number | MFCD00151044 |
| SMILES | C1=CC(=C(C=C1N)O)C(=O)[O-].O.O.[Na+] |
| Synonym | sodium 4-aminosalicylate dihydrate,sodium 4-amino-2-hydroxybenzoate dihydrate,parasal sodium,4-aminosalicylic acid sodium salt dihydrate,unii-s38b9w6axw,aminosalicylate sodium,sodium aminosalicylate,sodium p.a.s.,s38b9w6axw,aminosalicylate sodium usp |
| IUPAC Name | sodium;4-amino-2-hydroxybenzoate;dihydrate |
| InChI Key | GMUQJDAYXZXBOT-UHFFFAOYSA-M |
| Molecular Formula | C7H10NNaO5 |
Dimethyl 3-nitrophthalate, 98%
CAS: 13365-26-9 Molecular Formula: C10H9NO6 Molecular Weight (g/mol): 239.183 MDL Number: MFCD00017184 InChI Key: MLQMIKSBTAZNBK-UHFFFAOYSA-N PubChem CID: 249912 IUPAC Name: dimethyl 3-nitrobenzene-1,2-dicarboxylate SMILES: COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C(=O)OC
| PubChem CID | 249912 |
|---|---|
| CAS | 13365-26-9 |
| Molecular Weight (g/mol) | 239.183 |
| MDL Number | MFCD00017184 |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C(=O)OC |
| IUPAC Name | dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| InChI Key | MLQMIKSBTAZNBK-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO6 |
Thermo Scientific Chemicals Fluconazole, 98%
CAS: 86386-73-4 Molecular Formula: C13H12F2N6O Molecular Weight (g/mol): 306.27 MDL Number: MFCD00274549 InChI Key: RFHAOTPXVQNOHP-UHFFFAOYSA-N Synonym: fluconazole,diflucan,triflucan,elazor,biozolene,biocanol,fungata,fluconazol,fluconazolum,flucazol PubChem CID: 3365 ChEBI: CHEBI:46081 IUPAC Name: 2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol SMILES: C1=CC(=C(C=C1F)F)C(CN2C=NC=N2)(CN3C=NC=N3)O
| PubChem CID | 3365 |
|---|---|
| CAS | 86386-73-4 |
| Molecular Weight (g/mol) | 306.27 |
| ChEBI | CHEBI:46081 |
| MDL Number | MFCD00274549 |
| SMILES | C1=CC(=C(C=C1F)F)C(CN2C=NC=N2)(CN3C=NC=N3)O |
| Synonym | fluconazole,diflucan,triflucan,elazor,biozolene,biocanol,fungata,fluconazol,fluconazolum,flucazol |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol |
| InChI Key | RFHAOTPXVQNOHP-UHFFFAOYSA-N |
| Molecular Formula | C13H12F2N6O |
4-Methoxy-2-nitroaniline, 97%
CAS: 96-96-8 Molecular Formula: C7H8N2O3 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00007152 InChI Key: QFMJFXFXQAFGBO-UHFFFAOYSA-N Synonym: 2-nitro-4-methoxyaniline,4-amino-3-nitroanisole,fast bordeaux gp,2-nitro-p-anisidine,azobase nas,devol bordeaux b,bordeaux gp base,bordeaux gp salt,fast bordeaux gp base,fast bordeaux gp salt PubChem CID: 66793 ChEBI: CHEBI:48973 IUPAC Name: 4-methoxy-2-nitroaniline SMILES: COC1=CC(=C(C=C1)N)[N+](=O)[O-]
| PubChem CID | 66793 |
|---|---|
| CAS | 96-96-8 |
| Molecular Weight (g/mol) | 168.15 |
| ChEBI | CHEBI:48973 |
| MDL Number | MFCD00007152 |
| SMILES | COC1=CC(=C(C=C1)N)[N+](=O)[O-] |
| Synonym | 2-nitro-4-methoxyaniline,4-amino-3-nitroanisole,fast bordeaux gp,2-nitro-p-anisidine,azobase nas,devol bordeaux b,bordeaux gp base,bordeaux gp salt,fast bordeaux gp base,fast bordeaux gp salt |
| IUPAC Name | 4-methoxy-2-nitroaniline |
| InChI Key | QFMJFXFXQAFGBO-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O3 |
3,5-Dimethylbenzaldehyde, 98%
CAS: 5779-95-3 Molecular Formula: C9H10O Molecular Weight (g/mol): 134.178 MDL Number: MFCD00082777 InChI Key: NBEFMISJJNGCIZ-UHFFFAOYSA-N Synonym: benzaldehyde, 3,5-dimethyl,3,5-dimethyl benzaldehyde,m-xylene-5-carboxaldehyde,3,5-dimethyl-benzaldehyde,pubchem15515,acmc-1arkp,3,5-dimehtylbenzaldehyde,#,ksc494c0b,3,5-dimethylbenzaldehyde PubChem CID: 34225 IUPAC Name: 3,5-dimethylbenzaldehyde SMILES: CC1=CC(=CC(=C1)C=O)C
| PubChem CID | 34225 |
|---|---|
| CAS | 5779-95-3 |
| Molecular Weight (g/mol) | 134.178 |
| MDL Number | MFCD00082777 |
| SMILES | CC1=CC(=CC(=C1)C=O)C |
| Synonym | benzaldehyde, 3,5-dimethyl,3,5-dimethyl benzaldehyde,m-xylene-5-carboxaldehyde,3,5-dimethyl-benzaldehyde,pubchem15515,acmc-1arkp,3,5-dimehtylbenzaldehyde,#,ksc494c0b,3,5-dimethylbenzaldehyde |
| IUPAC Name | 3,5-dimethylbenzaldehyde |
| InChI Key | NBEFMISJJNGCIZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O |
5-Bromo-2-hydroxybenzophenone, 97%
CAS: 55082-33-2 Molecular Formula: C13H9BrO2 Molecular Weight (g/mol): 277.117 MDL Number: MFCD00525062 InChI Key: IVIICRNXAGUXLR-UHFFFAOYSA-N Synonym: 5-bromo-2-hydroxybenzophenone,5-bromo-2-hydroxyphenyl phenyl methanone,2-benzoyl-4-bromophenol,5-bromo-2-hydroxyphenyl-phenylmethanone,acmc-209lkx,5-bromo-2-hydroxy-benzophenone,5-bromo-2-hydroxyphenyl phenyl ketone,methanone, 5-bromo-2-hydroxyphenyl phenyl,5-bromo-2-hydroxy-phenyl-phenyl-methanone PubChem CID: 229009 IUPAC Name: (5-bromo-2-hydroxyphenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Br)O
| PubChem CID | 229009 |
|---|---|
| CAS | 55082-33-2 |
| Molecular Weight (g/mol) | 277.117 |
| MDL Number | MFCD00525062 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Br)O |
| Synonym | 5-bromo-2-hydroxybenzophenone,5-bromo-2-hydroxyphenyl phenyl methanone,2-benzoyl-4-bromophenol,5-bromo-2-hydroxyphenyl-phenylmethanone,acmc-209lkx,5-bromo-2-hydroxy-benzophenone,5-bromo-2-hydroxyphenyl phenyl ketone,methanone, 5-bromo-2-hydroxyphenyl phenyl,5-bromo-2-hydroxy-phenyl-phenyl-methanone |
| IUPAC Name | (5-bromo-2-hydroxyphenyl)-phenylmethanone |
| InChI Key | IVIICRNXAGUXLR-UHFFFAOYSA-N |
| Molecular Formula | C13H9BrO2 |
2,4-Dimethylbenzylamine, 98%
CAS: 94-98-4 Molecular Formula: C9H14N Molecular Weight (g/mol): 136.22 MDL Number: MFCD00025575 InChI Key: GBSUVYGVEQDZPG-UHFFFAOYSA-O Synonym: 2,4-dimethylbenzylamine,2,4-dimethylphenyl methanamine,benzenemethanamine, 2,4-dimethyl,benzylamine, 2,4-dimethyl,2,4-dimethylbenzenemethanamine,omega-amino-psi-cumene,1-2,4-dimethylphenyl methanamine,omega-amino-1,2,4-trimethylbenzene,rarechem al bw 0350,timtec-bb sbb005795 PubChem CID: 66761 IUPAC Name: (2,4-dimethylphenyl)methanamine SMILES: CC1=CC=C(C[NH3+])C(C)=C1
| PubChem CID | 66761 |
|---|---|
| CAS | 94-98-4 |
| Molecular Weight (g/mol) | 136.22 |
| MDL Number | MFCD00025575 |
| SMILES | CC1=CC=C(C[NH3+])C(C)=C1 |
| Synonym | 2,4-dimethylbenzylamine,2,4-dimethylphenyl methanamine,benzenemethanamine, 2,4-dimethyl,benzylamine, 2,4-dimethyl,2,4-dimethylbenzenemethanamine,omega-amino-psi-cumene,1-2,4-dimethylphenyl methanamine,omega-amino-1,2,4-trimethylbenzene,rarechem al bw 0350,timtec-bb sbb005795 |
| IUPAC Name | (2,4-dimethylphenyl)methanamine |
| InChI Key | GBSUVYGVEQDZPG-UHFFFAOYSA-O |
| Molecular Formula | C9H14N |
p-Toluenesulfonyl cyanide, 95%
CAS: 19158-51-1 Molecular Formula: C8H7NO2S Molecular Weight (g/mol): 181.21 InChI Key: JONIMGVUGJVFQD-UHFFFAOYSA-N Synonym: tosyl cyanide,p-toluenesulfonyl cyanide,4-methylbenzenesulfonyl cyanide,p-toluenesulphonyl cyanide,p-toluene sulfonyl cyanide,p-tolylsulfonyl cyanide,p-toluenesulfonylcyanide,benzenesulfonylcyanide, 4-methyl,benzenesulfonyl cyanide, 4-methyl,4-methylphenyl sulfonylformonitrile PubChem CID: 87946 IUPAC Name: (4-methylphenyl)sulfonylformonitrile SMILES: CC1=CC=C(C=C1)S(=O)(=O)C#N
| PubChem CID | 87946 |
|---|---|
| CAS | 19158-51-1 |
| Molecular Weight (g/mol) | 181.21 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C#N |
| Synonym | tosyl cyanide,p-toluenesulfonyl cyanide,4-methylbenzenesulfonyl cyanide,p-toluenesulphonyl cyanide,p-toluene sulfonyl cyanide,p-tolylsulfonyl cyanide,p-toluenesulfonylcyanide,benzenesulfonylcyanide, 4-methyl,benzenesulfonyl cyanide, 4-methyl,4-methylphenyl sulfonylformonitrile |
| IUPAC Name | (4-methylphenyl)sulfonylformonitrile |
| InChI Key | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO2S |
4'-(Bromomethyl)biphenyl-2-carbonitrile, 98%
CAS: 114772-54-2 Molecular Formula: C14H10BrN Molecular Weight (g/mol): 272.145 MDL Number: MFCD00671503 InChI Key: LFFIEVAMVPCZNA-UHFFFAOYSA-N Synonym: 4'-bromomethyl-2-cyanobiphenyl,2-4-bromomethyl phenyl benzonitrile,2-cyano-4'-bromomethylbiphenyl,4'-bromomethyl-1,1'-biphenyl-2-carbonitrile,2-4-bromo-methylphenyl benzonitrile,4'-bromomethyl-2-biphenylcarbonitrile,4'-bromomethylbiphenyl-2-carbonitrile,2'-cyano-4-bromomethylbiphenyl,4-2-cyanophenyl benzyl bromide,unii-ui5jr3k10f PubChem CID: 1501912 IUPAC Name: 2-[4-(bromomethyl)phenyl]benzonitrile SMILES: C1=CC=C(C(=C1)C#N)C2=CC=C(C=C2)CBr
| PubChem CID | 1501912 |
|---|---|
| CAS | 114772-54-2 |
| Molecular Weight (g/mol) | 272.145 |
| MDL Number | MFCD00671503 |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=C(C=C2)CBr |
| Synonym | 4'-bromomethyl-2-cyanobiphenyl,2-4-bromomethyl phenyl benzonitrile,2-cyano-4'-bromomethylbiphenyl,4'-bromomethyl-1,1'-biphenyl-2-carbonitrile,2-4-bromo-methylphenyl benzonitrile,4'-bromomethyl-2-biphenylcarbonitrile,4'-bromomethylbiphenyl-2-carbonitrile,2'-cyano-4-bromomethylbiphenyl,4-2-cyanophenyl benzyl bromide,unii-ui5jr3k10f |
| IUPAC Name | 2-[4-(bromomethyl)phenyl]benzonitrile |
| InChI Key | LFFIEVAMVPCZNA-UHFFFAOYSA-N |
| Molecular Formula | C14H10BrN |
3-Chlorobenzophenone, 98+%
CAS: 1016-78-0 Molecular Formula: C13H9ClO Molecular Weight (g/mol): 216.664 MDL Number: MFCD00009816 InChI Key: CPLWKNRPZVNELG-UHFFFAOYSA-N Synonym: 3-chlorobenzophenone,3-chlorophenyl phenyl methanone,benzophenone, 3-chloro,methanone, 3-chlorophenyl phenyl,m-chlorobenzophenone,3-chlorophenyl-phenylmethanone,methanone, 3-chlorophenyl pheny,3-chlorophenyl phenyl ketone,5-chlorobenzophenone,pubchem24414 PubChem CID: 66098 IUPAC Name: (3-chlorophenyl)-phenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl
| PubChem CID | 66098 |
|---|---|
| CAS | 1016-78-0 |
| Molecular Weight (g/mol) | 216.664 |
| MDL Number | MFCD00009816 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl |
| Synonym | 3-chlorobenzophenone,3-chlorophenyl phenyl methanone,benzophenone, 3-chloro,methanone, 3-chlorophenyl phenyl,m-chlorobenzophenone,3-chlorophenyl-phenylmethanone,methanone, 3-chlorophenyl pheny,3-chlorophenyl phenyl ketone,5-chlorobenzophenone,pubchem24414 |
| IUPAC Name | (3-chlorophenyl)-phenylmethanone |
| InChI Key | CPLWKNRPZVNELG-UHFFFAOYSA-N |
| Molecular Formula | C13H9ClO |
3,5-Difluoroaniline, 98+%
CAS: 372-39-4 Molecular Formula: C6H5F2N Molecular Weight (g/mol): 129.11 MDL Number: MFCD00007763 InChI Key: KQOIBXZRCYFZSO-UHFFFAOYSA-N Synonym: benzenamine, 3,5-difluoro,3,5-difluorobenzenamine,3,5-difluorophenylamine,5an,3,5-difluoranilin,3,5-difluoroanilin,3,5 difluoroaniline,3.5-difluoroaniline,pubchem2296,3, 5-difluoroaniline PubChem CID: 96595 IUPAC Name: 3,5-difluoroaniline SMILES: C1=C(C=C(C=C1F)F)N
| PubChem CID | 96595 |
|---|---|
| CAS | 372-39-4 |
| Molecular Weight (g/mol) | 129.11 |
| MDL Number | MFCD00007763 |
| SMILES | C1=C(C=C(C=C1F)F)N |
| Synonym | benzenamine, 3,5-difluoro,3,5-difluorobenzenamine,3,5-difluorophenylamine,5an,3,5-difluoranilin,3,5-difluoroanilin,3,5 difluoroaniline,3.5-difluoroaniline,pubchem2296,3, 5-difluoroaniline |
| IUPAC Name | 3,5-difluoroaniline |
| InChI Key | KQOIBXZRCYFZSO-UHFFFAOYSA-N |
| Molecular Formula | C6H5F2N |
2,3-Dihydroxybenzoic acid, 99%
CAS: 303-38-8 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.12 MDL Number: MFCD00002446 InChI Key: GLDQAMYCGOIJDV-UHFFFAOYSA-N Synonym: pyrocatechuic acid,o-pyrocatechuic acid,2-pyrocatechuic acid,3-hydroxysalicylic acid,dobk,dhba,2,3-dihydroxybenzoicacid,benzoic acid, 2,3-dihydroxy,catecholcarboxylic acid,2,3-dihydroxy-benzoic acid PubChem CID: 19 ChEBI: CHEBI:18026 IUPAC Name: 2,3-dihydroxybenzoic acid SMILES: C1=CC(=C(C(=C1)O)O)C(=O)O
| PubChem CID | 19 |
|---|---|
| CAS | 303-38-8 |
| Molecular Weight (g/mol) | 154.12 |
| ChEBI | CHEBI:18026 |
| MDL Number | MFCD00002446 |
| SMILES | C1=CC(=C(C(=C1)O)O)C(=O)O |
| Synonym | pyrocatechuic acid,o-pyrocatechuic acid,2-pyrocatechuic acid,3-hydroxysalicylic acid,dobk,dhba,2,3-dihydroxybenzoicacid,benzoic acid, 2,3-dihydroxy,catecholcarboxylic acid,2,3-dihydroxy-benzoic acid |
| IUPAC Name | 2,3-dihydroxybenzoic acid |
| InChI Key | GLDQAMYCGOIJDV-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
Miconazole, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 22916-47-8 Molecular Formula: C18H14Cl4N2O Molecular Weight (g/mol): 416.12 MDL Number: MFCD00216019 InChI Key: BYBLEWFAAKGYCD-UHFFFAOYNA-N IUPAC Name: 1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-1H-imidazole SMILES: ClC1=CC=C(COC(CN2C=CN=C2)C2=CC=C(Cl)C=C2Cl)C(Cl)=C1
| CAS | 22916-47-8 |
|---|---|
| Molecular Weight (g/mol) | 416.12 |
| MDL Number | MFCD00216019 |
| SMILES | ClC1=CC=C(COC(CN2C=CN=C2)C2=CC=C(Cl)C=C2Cl)C(Cl)=C1 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-1H-imidazole |
| InChI Key | BYBLEWFAAKGYCD-UHFFFAOYNA-N |
| Molecular Formula | C18H14Cl4N2O |